ChemNet > CAS > 261762-82-7 2-Chloro-6-fluoro-3-methylbenzoyl chloride
261762-82-7 2-Chloro-6-fluoro-3-methylbenzoyl chloride
| termék neve |
2-Chloro-6-fluoro-3-methylbenzoyl chloride |
| Szinonimák |
2-Chloro-6-fluoro-m-toluoyl chloride |
| MF |
C8H5Cl2FO |
| Molekulatömeg |
207.0291 |
| InChI |
InChI=1/C8H5Cl2FO/c1-4-2-3-5(11)6(7(4)9)8(10)12/h2-3H,1H3 |
| CAS-szám |
261762-82-7 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.396g/cm3 |
| Forráspont |
245.6°C at 760 mmHg |
| Törésmutató |
1.535 |
| Gyulladáspont |
102.3°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R34:Causes burns.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
